C17H25FN2O2 — CID 110898141
1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 110898141) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 110898141 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | OC(CN1CCOCC1)CN(Cc1cccc(F)c1)C1CC1 |
| InChI | InChI=1S/C17H25FN2O2/c18-15-3-1-2-14(10-15)11-20(16-4-5-16)13-17(21)12-19-6-8-22-9-7-19/h1-3,10,16-17,21H,4-9,11-13H2 |
| InChIKey | JKZAYMMIBZIGJQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |