C15H23FN2O2 — CID 60910058
1-[2-(3-fluorophenyl)ethylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 60910058) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)ethylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[2-(3-fluorophenyl)ethylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 60910058 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[2-(3-fluorophenyl)ethylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | OC(CNCCc1cccc(F)c1)CN1CCOCC1 |
| InChI | InChI=1S/C15H23FN2O2/c16-14-3-1-2-13(10-14)4-5-17-11-15(19)12-18-6-8-20-9-7-18/h1-3,10,15,17,19H,4-9,11-12H2 |
| InChIKey | LXUGQJVATRKIEU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|