C13H17F3N2O2 — CID 60896358
1-morpholin-4-yl-3-(2,3,4-trifluoroanilino)propan-2-ol (PubChem CID 60896358) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-morpholin-4-yl-3-(2,3,4-trifluoroanilino)propan-2-ol.
| Compound Name | 1-morpholin-4-yl-3-(2,3,4-trifluoroanilino)propan-2-ol |
|---|---|
| PubChem CID | 60896358 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-morpholin-4-yl-3-(2,3,4-trifluoroanilino)propan-2-ol |
| SMILES | OC(CNc1ccc(F)c(F)c1F)CN1CCOCC1 |
| InChI | InChI=1S/C13H17F3N2O2/c14-10-1-2-11(13(16)12(10)15)17-7-9(19)8-18-3-5-20-6-4-18/h1-2,9,17,19H,3-8H2 |
| InChIKey | VDKYEVJQQYDAHM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|