C16H20FN3O2 — CID 97236554
(2S)-1-[(7-fluoroquinolin-2-yl)amino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 97236554) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is (2S)-1-[(7-fluoroquinolin-2-yl)amino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[(7-fluoroquinolin-2-yl)amino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 97236554 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (2S)-1-[(7-fluoroquinolin-2-yl)amino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | O[C@@H](CNc1ccc2ccc(F)cc2n1)CN1CCOCC1 |
| InChI | InChI=1S/C16H20FN3O2/c17-13-3-1-12-2-4-16(19-15(12)9-13)18-10-14(21)11-20-5-7-22-8-6-20/h1-4,9,14,21H,5-8,10-11H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | WHTBOJXKZBGEIP-AWEZNQCLSA-N |
| XLogP | 1.48 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |