C19H25NO4 — CID 93163974
(2S)-1-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 93163974) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (2S)-1-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | (2S)-1-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 93163974 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (2S)-1-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | COc1ccc(CN(C[C@H](O)COCc2ccco2)C2CC2)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-22-18-8-4-15(5-9-18)11-20(16-6-7-16)12-17(21)13-23-14-19-3-2-10-24-19/h2-5,8-10,16-17,21H,6-7,11-14H2,1H3/t17-/m0/s1 |
| InChIKey | YJDRPYWEOVRPLW-KRWDZBQOSA-N |
| XLogP | 2.83 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |