C20H20FNO3 — CID 111113377
2-[[[2-(4-fluorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]methyl]phenol (PubChem CID 111113377) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2-[[[2-(4-fluorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2-[[[2-(4-fluorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 111113377 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[[[2-(4-fluorophenyl)-2-hydroxyethyl]-(furan-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CN(Cc1ccco1)CC(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO3/c21-17-9-7-15(8-10-17)20(24)14-22(13-18-5-3-11-25-18)12-16-4-1-2-6-19(16)23/h1-11,20,23-24H,12-14H2 |
| InChIKey | FBBZSVOHBVBEGW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|