C19H27NO4 — CID 93164184
(2S)-1-[furan-2-ylmethyl-[(2-methoxyphenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol (PubChem CID 93164184) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2S)-1-[furan-2-ylmethyl-[(2-methoxyphenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | (2S)-1-[furan-2-ylmethyl-[(2-methoxyphenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 93164184 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2S)-1-[furan-2-ylmethyl-[(2-methoxyphenyl)methyl]amino]-3-propan-2-yloxypropan-2-ol |
| SMILES | COc1ccccc1CN(Cc1ccco1)C[C@H](O)COC(C)C |
| InChI | InChI=1S/C19H27NO4/c1-15(2)24-14-17(21)12-20(13-18-8-6-10-23-18)11-16-7-4-5-9-19(16)22-3/h4-10,15,17,21H,11-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | VNEDRWYABUADGP-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |