C24H28ClN2O4S+ — CID 2223442
(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl-[2-(4-sulfamoylphenyl)ethyl]azanium (PubChem CID 2223442) has the molecular formula C24H28ClN2O4S+ and a molecular weight of 476.02 g/mol. Its IUPAC name is (3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl-[2-(4-sulfamoylphenyl)ethyl]azanium.
| Compound Name | (3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl-[2-(4-sulfamoylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2223442 |
| Molecular Formula | C24H28ClN2O4S+ |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (3-chloro-5-ethoxy-4-phenylmethoxyphenyl)methyl-[2-(4-sulfamoylphenyl)ethyl]azanium |
| SMILES | CCOc1cc(C[NH2+]CCc2ccc(S(N)(=O)=O)cc2)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H27ClN2O4S/c1-2-30-23-15-20(14-22(25)24(23)31-17-19-6-4-3-5-7-19)16-27-13-12-18-8-10-21(11-9-18)32(26,28)29/h3-11,14-15,27H,2,12-13,16-17H2,1H3,(H2,26,28,29)/p+1 |
| InChIKey | QEKXMFFGXAXIOU-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|