C22H23BrFN2O3S+ — CID 2712305
[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium (PubChem CID 2712305) has the molecular formula C22H23BrFN2O3S+ and a molecular weight of 494.41 g/mol. Its IUPAC name is [5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium.
| Compound Name | [5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2712305 |
| Molecular Formula | C22H23BrFN2O3S+ |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | [5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methyl-[2-(4-sulfamoylphenyl)ethyl]azanium |
| SMILES | NS(=O)(=O)c1ccc(CC[NH2+]Cc2cc(Br)ccc2OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C22H22BrFN2O3S/c23-19-7-10-22(29-15-17-3-1-2-4-21(17)24)18(13-19)14-26-12-11-16-5-8-20(9-6-16)30(25,27)28/h1-10,13,26H,11-12,14-15H2,(H2,25,27,28)/p+1 |
| InChIKey | WXHAMWYRTOAPAH-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|