C17H20F2NO3+ — CID 3490601
(2,5-difluorophenyl)methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium (PubChem CID 3490601) has the molecular formula C17H20F2NO3+ and a molecular weight of 324.35 g/mol. Its IUPAC name is (2,5-difluorophenyl)methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium.
| Compound Name | (2,5-difluorophenyl)methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 3490601 |
| Molecular Formula | C17H20F2NO3+ |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2,5-difluorophenyl)methyl-[(3,4,5-trimethoxyphenyl)methyl]azanium |
| SMILES | COc1cc(C[NH2+]Cc2cc(F)ccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C17H19F2NO3/c1-21-15-6-11(7-16(22-2)17(15)23-3)9-20-10-12-8-13(18)4-5-14(12)19/h4-8,20H,9-10H2,1-3H3/p+1 |
| InChIKey | JKKLZMOMFZJAQA-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |