C21H24NO3+ — CID 7452688
naphthalen-1-ylmethyl-[(3,4,5-trimethoxyphenyl)methyl]azanium (PubChem CID 7452688) has the molecular formula C21H24NO3+ and a molecular weight of 338.43 g/mol. Its IUPAC name is naphthalen-1-ylmethyl-[(3,4,5-trimethoxyphenyl)methyl]azanium.
| Compound Name | naphthalen-1-ylmethyl-[(3,4,5-trimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 7452688 |
| Molecular Formula | C21H24NO3+ |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | naphthalen-1-ylmethyl-[(3,4,5-trimethoxyphenyl)methyl]azanium |
| SMILES | COc1cc(C[NH2+]Cc2cccc3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C21H23NO3/c1-23-19-11-15(12-20(24-2)21(19)25-3)13-22-14-17-9-6-8-16-7-4-5-10-18(16)17/h4-12,22H,13-14H2,1-3H3/p+1 |
| InChIKey | LDGLROHFOYNQJH-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |