C17H22NO3+ — CID 91929332
(4-methylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium (PubChem CID 91929332) has the molecular formula C17H22NO3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is (4-methylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium.
| Compound Name | (4-methylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 91929332 |
| Molecular Formula | C17H22NO3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | (4-methylphenyl)-[(3,4,5-trimethoxyphenyl)methyl]azanium |
| SMILES | COc1cc(C[NH2+]c2ccc(C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H21NO3/c1-12-5-7-14(8-6-12)18-11-13-9-15(19-2)17(21-4)16(10-13)20-3/h5-10,18H,11H2,1-4H3/p+1 |
| InChIKey | WNPKGWVHMDSGQK-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|