C17H20BrNO3 — CID 1115726
2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 1115726) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 1115726 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(CNc2ccc(C)cc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C17H20BrNO3/c1-11-5-6-14(13(18)7-11)19-10-12-8-15(20-2)17(22-4)16(9-12)21-3/h5-9,19H,10H2,1-4H3 |
| InChIKey | HXGWFXLZAHEBTL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |