C19H22BrNO7 — CID 17367543
2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline;oxalic acid (PubChem CID 17367543) has the molecular formula C19H22BrNO7 and a molecular weight of 456.29 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline;oxalic acid.
| Compound Name | 2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline;oxalic acid |
|---|---|
| PubChem CID | 17367543 |
| Molecular Formula | C19H22BrNO7 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2-bromo-4-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]aniline;oxalic acid |
| SMILES | COc1cc(CNc2ccc(C)cc2Br)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H20BrNO3.C2H2O4/c1-11-5-6-14(13(18)7-11)19-10-12-8-15(20-2)17(22-4)16(9-12)21-3;3-1(4)2(5)6/h5-9,19H,10H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | LYXJWSYEPUTZHV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|