C15H20ClNO5 — CID 97179268
2-[2-chloro-6-ethoxy-4-(hydroxymethyl)phenoxy]-1-morpholin-4-ylethanone (PubChem CID 97179268) has the molecular formula C15H20ClNO5 and a molecular weight of 329.78 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-(hydroxymethyl)phenoxy]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-chloro-6-ethoxy-4-(hydroxymethyl)phenoxy]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 97179268 |
| Molecular Formula | C15H20ClNO5 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-(hydroxymethyl)phenoxy]-1-morpholin-4-ylethanone |
| SMILES | CCOc1cc(CO)cc(Cl)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H20ClNO5/c1-2-21-13-8-11(9-18)7-12(16)15(13)22-10-14(19)17-3-5-20-6-4-17/h7-8,18H,2-6,9-10H2,1H3 |
| InChIKey | PNDNJKXMPOKEFK-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |