C17H28BrCl2N3O4 — CID 44663713
[4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium dichloride (PubChem CID 44663713) has the molecular formula C17H28BrCl2N3O4 and a molecular weight of 489.24 g/mol. Its IUPAC name is [4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium dichloride.
| Compound Name | [4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium dichloride |
|---|---|
| PubChem CID | 44663713 |
| Molecular Formula | C17H28BrCl2N3O4 |
| Molecular Weight | 489.24 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | [4-(2-amino-2-oxoethoxy)-3-bromo-5-methoxyphenyl]methyl-(3-morpholin-4-ium-4-ylpropyl)azanium dichloride |
| SMILES | COc1cc(C[NH2+]CCC[NH+]2CCOCC2)cc(Br)c1OCC(N)=O.[Cl-].[Cl-] |
| InChI | InChI=1S/C17H26BrN3O4.2ClH/c1-23-15-10-13(9-14(18)17(15)25-12-16(19)22)11-20-3-2-4-21-5-7-24-8-6-21;;/h9-10,20H,2-8,11-12H2,1H3,(H2,19,22);2*1H |
| InChIKey | IBZFCQDKNXVWLR-UHFFFAOYSA-N |
| XLogP | -7.30 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.24 |
| LogP ≤ 5 | -7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|