C10H11ClN2S — CID 82549012
4-chloro-6-ethyl-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 82549012) has the molecular formula C10H11ClN2S and a molecular weight of 226.73 g/mol. Its IUPAC name is 4-chloro-6-ethyl-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 4-chloro-6-ethyl-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549012 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-chloro-6-ethyl-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CCc1cc(Cl)c2nc(NC)sc2c1 |
| InChI | InChI=1S/C10H11ClN2S/c1-3-6-4-7(11)9-8(5-6)14-10(12-2)13-9/h4-5H,3H2,1-2H3,(H,12,13) |
| InChIKey | IVAWCWJAFLLSCQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |