C11H14ClNS — CID 154657873
4-chloro-6-ethyl-1,3-benzothiazole;ethane (PubChem CID 154657873) has the molecular formula C11H14ClNS and a molecular weight of 227.76 g/mol. Its IUPAC name is 4-chloro-6-ethyl-1,3-benzothiazole;ethane.
| Compound Name | 4-chloro-6-ethyl-1,3-benzothiazole;ethane |
|---|---|
| PubChem CID | 154657873 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 4-chloro-6-ethyl-1,3-benzothiazole;ethane |
| SMILES | CC.CCc1cc(Cl)c2ncsc2c1 |
| InChI | InChI=1S/C9H8ClNS.C2H6/c1-2-6-3-7(10)9-8(4-6)12-5-11-9;1-2/h3-5H,2H2,1H3;1-2H3 |
| InChIKey | JKGMLPDAFVSXEZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |