C9H8ClNO — CID 155002998
4-chloro-6-ethyl-1,3-benzoxazole (PubChem CID 155002998) has the molecular formula C9H8ClNO and a molecular weight of 181.62 g/mol. Its IUPAC name is 4-chloro-6-ethyl-1,3-benzoxazole.
| Compound Name | 4-chloro-6-ethyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 155002998 |
| Molecular Formula | C9H8ClNO |
| Molecular Weight | 181.62 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 4-chloro-6-ethyl-1,3-benzoxazole |
| SMILES | CCc1cc(Cl)c2ncoc2c1 |
| InChI | InChI=1S/C9H8ClNO/c1-2-6-3-7(10)9-8(4-6)12-5-11-9/h3-5H,2H2,1H3 |
| InChIKey | DGZIMVLGOYAAIN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |