C9H9BrN2OS — CID 82549421
4-bromo-6-methoxy-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 82549421) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is 4-bromo-6-methoxy-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 4-bromo-6-methoxy-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549421 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 4-bromo-6-methoxy-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2c(Br)cc(OC)cc2s1 |
| InChI | InChI=1S/C9H9BrN2OS/c1-11-9-12-8-6(10)3-5(13-2)4-7(8)14-9/h3-4H,1-2H3,(H,11,12) |
| InChIKey | VZTIUPNQPXNXRB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |