C9H9BrN2S — CID 82549197
6-bromo-N,5-dimethyl-1,3-benzothiazol-2-amine (PubChem CID 82549197) has the molecular formula C9H9BrN2S and a molecular weight of 257.16 g/mol. Its IUPAC name is 6-bromo-N,5-dimethyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-bromo-N,5-dimethyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549197 |
| Molecular Formula | C9H9BrN2S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 6-bromo-N,5-dimethyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2cc(C)c(Br)cc2s1 |
| InChI | InChI=1S/C9H9BrN2S/c1-5-3-7-8(4-6(5)10)13-9(11-2)12-7/h3-4H,1-2H3,(H,11,12) |
| InChIKey | DNBSWFFJRQKWCP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |