C12H19N3S — CID 142222190
ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine (PubChem CID 142222190) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine.
| Compound Name | ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine |
|---|---|
| PubChem CID | 142222190 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine |
| SMILES | CC.CCNc1ccc2sc(NC)nc2c1 |
| InChI | InChI=1S/C10H13N3S.C2H6/c1-3-12-7-4-5-9-8(6-7)13-10(11-2)14-9;1-2/h4-6,12H,3H2,1-2H3,(H,11,13);1-2H3 |
| InChIKey | PUUXNTUKTOUBPG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |