About ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine
ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine (PubChem CID 142222190) has the molecular formula C12H19N3S
and a molecular weight of 237.37 g/mol. Its IUPAC name is ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine.
Molecular Properties
| Compound Name | ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine |
| PubChem CID | 142222190 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine |
| SMILES | CC.CCNc1ccc2sc(NC)nc2c1 |
| InChI | InChI=1S/C10H13N3S.C2H6/c1-3-12-7-4-5-9-8(6-7)13-10(11-2)14-9;1-2/h4-6,12H,3H2,1-2H3,(H,11,13);1-2H3 |
| InChIKey | PUUXNTUKTOUBPG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine?
The IUPAC name of ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine (CID 142222190) is ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine.
What is the SMILES notation for ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine?
The canonical SMILES for ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine is CC.CCNc1ccc2sc(NC)nc2c1.
What is the InChIKey of ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine?
The InChIKey is PUUXNTUKTOUBPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3S.C2H6/c1-3-12-7-4-5-9-8(6-7)13-10(11-2)14-9;1-2/h4-6,12H,3H2,1-2H3,(H,11,13);1-2H3.
What are the key properties of ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine?
ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine has a molecular weight of 237.37 g/mol, XLogP of 3.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-N-ethyl-2-N-methyl-1,3-benzothiazole-2,5-diamine is sourced from PubChem (CID 142222190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).