C9H11N3O2S — CID 163117789
2-(ethylamino)-N-hydroxy-1,3-benzothiazol-5-amine oxide (PubChem CID 163117789) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-(ethylamino)-N-hydroxy-1,3-benzothiazol-5-amine oxide.
| Compound Name | 2-(ethylamino)-N-hydroxy-1,3-benzothiazol-5-amine oxide |
|---|---|
| PubChem CID | 163117789 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 2-(ethylamino)-N-hydroxy-1,3-benzothiazol-5-amine oxide |
| SMILES | CCNc1nc2cc([NH+]([O-])O)ccc2s1 |
| InChI | InChI=1S/C9H11N3O2S/c1-2-10-9-11-7-5-6(12(13)14)3-4-8(7)15-9/h3-5,12-13H,2H2,1H3,(H,10,11) |
| InChIKey | ALFLCROFXGBSFJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|