C11H11FN2O2S — CID 60810692
ethyl 2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]acetate (PubChem CID 60810692) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is ethyl 2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]acetate.
| Compound Name | ethyl 2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]acetate |
|---|---|
| PubChem CID | 60810692 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | ethyl 2-[(5-fluoro-1,3-benzothiazol-2-yl)amino]acetate |
| SMILES | CCOC(=O)CNc1nc2cc(F)ccc2s1 |
| InChI | InChI=1S/C11H11FN2O2S/c1-2-16-10(15)6-13-11-14-8-5-7(12)3-4-9(8)17-11/h3-5H,2,6H2,1H3,(H,13,14) |
| InChIKey | NOHNUEYVDAJQNB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |