C10H7F5N2S — CID 106294883
5-fluoro-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazol-2-amine (PubChem CID 106294883) has the molecular formula C10H7F5N2S and a molecular weight of 282.24 g/mol. Its IUPAC name is 5-fluoro-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazol-2-amine.
| Compound Name | 5-fluoro-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 106294883 |
| Molecular Formula | C10H7F5N2S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 5-fluoro-N-(2,2,3,3-tetrafluoropropyl)-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2sc(NCC(F)(F)C(F)F)nc2c1 |
| InChI | InChI=1S/C10H7F5N2S/c11-5-1-2-7-6(3-5)17-9(18-7)16-4-10(14,15)8(12)13/h1-3,8H,4H2,(H,16,17) |
| InChIKey | KOMHGXPQADNBEX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|