C12H15FN2O2S — CID 114101101
N-(2,3-dimethoxypropyl)-5-fluoro-1,3-benzothiazol-2-amine (PubChem CID 114101101) has the molecular formula C12H15FN2O2S and a molecular weight of 270.33 g/mol. Its IUPAC name is N-(2,3-dimethoxypropyl)-5-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | N-(2,3-dimethoxypropyl)-5-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 114101101 |
| Molecular Formula | C12H15FN2O2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N-(2,3-dimethoxypropyl)-5-fluoro-1,3-benzothiazol-2-amine |
| SMILES | COCC(CNc1nc2cc(F)ccc2s1)OC |
| InChI | InChI=1S/C12H15FN2O2S/c1-16-7-9(17-2)6-14-12-15-10-5-8(13)3-4-11(10)18-12/h3-5,9H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | MJDABICQEIDCEK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |