C11H13ClN2S — CID 140701361
6-chloro-N-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine (PubChem CID 140701361) has the molecular formula C11H13ClN2S and a molecular weight of 240.76 g/mol. Its IUPAC name is 6-chloro-N-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine.
| Compound Name | 6-chloro-N-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 140701361 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 6-chloro-N-methyl-4-propan-2-yl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2c(C(C)C)cc(Cl)cc2s1 |
| InChI | InChI=1S/C11H13ClN2S/c1-6(2)8-4-7(12)5-9-10(8)14-11(13-3)15-9/h4-6H,1-3H3,(H,13,14) |
| InChIKey | OVKRHKBBSOGWNU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |