C11H13ClN2O3S — CID 96710360
7-chloro-4,5,6-trimethoxy-N-methyl-1,3-benzothiazol-2-amine (PubChem CID 96710360) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 7-chloro-4,5,6-trimethoxy-N-methyl-1,3-benzothiazol-2-amine.
| Compound Name | 7-chloro-4,5,6-trimethoxy-N-methyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 96710360 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 7-chloro-4,5,6-trimethoxy-N-methyl-1,3-benzothiazol-2-amine |
| SMILES | CNc1nc2c(OC)c(OC)c(OC)c(Cl)c2s1 |
| InChI | InChI=1S/C11H13ClN2O3S/c1-13-11-14-6-8(16-3)9(17-4)7(15-2)5(12)10(6)18-11/h1-4H3,(H,13,14) |
| InChIKey | XACZBCXLFDFFCY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |