C17H18N2S2 — CID 82548837
6-ethylsulfanyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine (PubChem CID 82548837) has the molecular formula C17H18N2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 6-ethylsulfanyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-ethylsulfanyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82548837 |
| Molecular Formula | C17H18N2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-ethylsulfanyl-N-(2-phenylethyl)-1,3-benzothiazol-2-amine |
| SMILES | CCSc1ccc2nc(NCCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C17H18N2S2/c1-2-20-14-8-9-15-16(12-14)21-17(19-15)18-11-10-13-6-4-3-5-7-13/h3-9,12H,2,10-11H2,1H3,(H,18,19) |
| InChIKey | OYBFMXWPMIICNR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |