C25H21ClN4OS2 — CID 59852381
(4S)-4-benzyl-2-[4-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one (PubChem CID 59852381) has the molecular formula C25H21ClN4OS2 and a molecular weight of 493.06 g/mol. Its IUPAC name is (4S)-4-benzyl-2-[4-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one.
| Compound Name | (4S)-4-benzyl-2-[4-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 59852381 |
| Molecular Formula | C25H21ClN4OS2 |
| Molecular Weight | 493.06 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | (4S)-4-benzyl-2-[4-[2-[(6-chloro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one |
| SMILES | O=C1SC(Nc2ccc(CCNc3nc4ccc(Cl)cc4s3)cc2)=N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H21ClN4OS2/c26-18-8-11-20-22(15-18)32-24(29-20)27-13-12-16-6-9-19(10-7-16)28-25-30-21(23(31)33-25)14-17-4-2-1-3-5-17/h1-11,15,21H,12-14H2,(H,27,29)(H,28,30)/t21-/m0/s1 |
| InChIKey | QNBCYJGYEYWPKM-NRFANRHFSA-N |
| XLogP | 6.26 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.06 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|