C19H18N4OS2 — CID 58628098
(4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-4-methyl-4H-1,3-thiazol-5-one (PubChem CID 58628098) has the molecular formula C19H18N4OS2 and a molecular weight of 382.51 g/mol. Its IUPAC name is (4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-4-methyl-4H-1,3-thiazol-5-one.
| Compound Name | (4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-4-methyl-4H-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 58628098 |
| Molecular Formula | C19H18N4OS2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | (4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-4-methyl-4H-1,3-thiazol-5-one |
| SMILES | C[C@@H]1N=C(Nc2ccc(CCNc3nc4ccccc4s3)cc2)SC1=O |
| InChI | InChI=1S/C19H18N4OS2/c1-12-17(24)26-19(21-12)22-14-8-6-13(7-9-14)10-11-20-18-23-15-4-2-3-5-16(15)25-18/h2-9,12H,10-11H2,1H3,(H,20,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | KMPPXEMQVVUNIC-LBPRGKRZSA-N |
| XLogP | 4.38 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|