C22H23N5O3S2 — CID 58628131
(4S)-4-(2-methylpropyl)-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one (PubChem CID 58628131) has the molecular formula C22H23N5O3S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is (4S)-4-(2-methylpropyl)-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one.
| Compound Name | (4S)-4-(2-methylpropyl)-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 58628131 |
| Molecular Formula | C22H23N5O3S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (4S)-4-(2-methylpropyl)-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one |
| SMILES | CC(C)C[C@@H]1N=C(Nc2ccc(CCNc3nc4ccc([N+](=O)[O-])cc4s3)cc2)SC1=O |
| InChI | InChI=1S/C22H23N5O3S2/c1-13(2)11-18-20(28)32-22(26-18)24-15-5-3-14(4-6-15)9-10-23-21-25-17-8-7-16(27(29)30)12-19(17)31-21/h3-8,12-13,18H,9-11H2,1-2H3,(H,23,25)(H,24,26)/t18-/m0/s1 |
| InChIKey | UTVSIJCIKQKTMJ-SFHVURJKSA-N |
| XLogP | 5.32 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|