C23H26N4OS2 — CID 59852385
(4S)-2-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4-(2-methylpropyl)-4H-1,3-thiazol-5-one (PubChem CID 59852385) has the molecular formula C23H26N4OS2 and a molecular weight of 438.62 g/mol. Its IUPAC name is (4S)-2-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4-(2-methylpropyl)-4H-1,3-thiazol-5-one.
| Compound Name | (4S)-2-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4-(2-methylpropyl)-4H-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 59852385 |
| Molecular Formula | C23H26N4OS2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (4S)-2-[4-[2-[(6-methyl-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4-(2-methylpropyl)-4H-1,3-thiazol-5-one |
| SMILES | Cc1ccc2nc(NCCc3ccc(NC4=N[C@@H](CC(C)C)C(=O)S4)cc3)sc2c1 |
| InChI | InChI=1S/C23H26N4OS2/c1-14(2)12-19-21(28)30-23(27-19)25-17-7-5-16(6-8-17)10-11-24-22-26-18-9-4-15(3)13-20(18)29-22/h4-9,13-14,19H,10-12H2,1-3H3,(H,24,26)(H,25,27)/t19-/m0/s1 |
| InChIKey | KYYYNDQWMXFWAK-IBGZPJMESA-N |
| XLogP | 5.72 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|