C19H17N5O3S2 — CID 58627956
(4S)-4-methyl-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one (PubChem CID 58627956) has the molecular formula C19H17N5O3S2 and a molecular weight of 427.51 g/mol. Its IUPAC name is (4S)-4-methyl-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one.
| Compound Name | (4S)-4-methyl-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one |
|---|---|
| PubChem CID | 58627956 |
| Molecular Formula | C19H17N5O3S2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (4S)-4-methyl-2-[4-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]anilino]-4H-1,3-thiazol-5-one |
| SMILES | C[C@@H]1N=C(Nc2ccc(CCNc3nc4ccc([N+](=O)[O-])cc4s3)cc2)SC1=O |
| InChI | InChI=1S/C19H17N5O3S2/c1-11-17(25)29-19(21-11)22-13-4-2-12(3-5-13)8-9-20-18-23-15-7-6-14(24(26)27)10-16(15)28-18/h2-7,10-11H,8-9H2,1H3,(H,20,23)(H,21,22)/t11-/m0/s1 |
| InChIKey | SMJVDTZIBDMWND-NSHDSACASA-N |
| XLogP | 4.29 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|