C21H18FN4O2S+ — CID 118365004
N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 118365004) has the molecular formula C21H18FN4O2S+ and a molecular weight of 409.47 g/mol. Its IUPAC name is N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 118365004 |
| Molecular Formula | C21H18FN4O2S+ |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[2-[1-[(4-fluorophenyl)methyl]pyridin-1-ium-4-yl]ethyl]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NCCc3cc[n+](Cc4ccc(F)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C21H18FN4O2S/c22-17-3-1-16(2-4-17)14-25-11-8-15(9-12-25)7-10-23-21-24-19-6-5-18(26(27)28)13-20(19)29-21/h1-6,8-9,11-13H,7,10,14H2,(H,23,24)/q+1 |
| InChIKey | PRXIEXWZIFEMSH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|