C17H14F3N3O3S — CID 56575244
6-nitro-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3-benzothiazol-2-amine (PubChem CID 56575244) has the molecular formula C17H14F3N3O3S and a molecular weight of 397.38 g/mol. Its IUPAC name is 6-nitro-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-nitro-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 56575244 |
| Molecular Formula | C17H14F3N3O3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 6-nitro-N-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NCc3ccc(COCC(F)(F)F)cc3)sc2c1 |
| InChI | InChI=1S/C17H14F3N3O3S/c18-17(19,20)10-26-9-12-3-1-11(2-4-12)8-21-16-22-14-6-5-13(23(24)25)7-15(14)27-16/h1-7H,8-10H2,(H,21,22) |
| InChIKey | YHIPPYQKPYBLFV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|