C17H13F3N2O2S — CID 35848386
N-(1,3-benzothiazol-2-yl)-4-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 35848386) has the molecular formula C17H13F3N2O2S and a molecular weight of 366.36 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 35848386 |
| Molecular Formula | C17H13F3N2O2S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F3N2O2S/c18-17(19,20)10-24-9-11-5-7-12(8-6-11)15(23)22-16-21-13-3-1-2-4-14(13)25-16/h1-8H,9-10H2,(H,21,22,23) |
| InChIKey | XALVGWDXBOQNTO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |