C32H27N5O3S — CID 58628033
(4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-1-benzoyl-4-[(4-hydroxyphenyl)methyl]-4H-imidazol-5-one (PubChem CID 58628033) has the molecular formula C32H27N5O3S and a molecular weight of 561.67 g/mol. Its IUPAC name is (4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-1-benzoyl-4-[(4-hydroxyphenyl)methyl]-4H-imidazol-5-one.
| Compound Name | (4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-1-benzoyl-4-[(4-hydroxyphenyl)methyl]-4H-imidazol-5-one |
|---|---|
| PubChem CID | 58628033 |
| Molecular Formula | C32H27N5O3S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (4S)-2-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]anilino]-1-benzoyl-4-[(4-hydroxyphenyl)methyl]-4H-imidazol-5-one |
| SMILES | O=C(c1ccccc1)N1C(=O)[C@H](Cc2ccc(O)cc2)N=C1Nc1ccc(CCNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C32H27N5O3S/c38-25-16-12-22(13-17-25)20-27-30(40)37(29(39)23-6-2-1-3-7-23)31(35-27)34-24-14-10-21(11-15-24)18-19-33-32-36-26-8-4-5-9-28(26)41-32/h1-17,27,38H,18-20H2,(H,33,36)(H,34,35)/t27-/m0/s1 |
| InChIKey | KZFALXVJBNVUDY-MHZLTWQESA-N |
| XLogP | 5.72 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|