C15H15N3OS — CID 63231374
4-[2-[(6-amino-1,3-benzothiazol-2-yl)amino]ethyl]phenol (PubChem CID 63231374) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-[2-[(6-amino-1,3-benzothiazol-2-yl)amino]ethyl]phenol.
| Compound Name | 4-[2-[(6-amino-1,3-benzothiazol-2-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 63231374 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-[2-[(6-amino-1,3-benzothiazol-2-yl)amino]ethyl]phenol |
| SMILES | Nc1ccc2nc(NCCc3ccc(O)cc3)sc2c1 |
| InChI | InChI=1S/C15H15N3OS/c16-11-3-6-13-14(9-11)20-15(18-13)17-8-7-10-1-4-12(19)5-2-10/h1-6,9,19H,7-8,16H2,(H,17,18) |
| InChIKey | LNWQFHPDVYMFOS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|