C26H36N4O2S — CID 143137328
2-N-[2-[4-(spiro[4.6]undecan-9-ylideneamino)phenyl]ethyl]-1,3-benzothiazole-2,6-diamine;dihydrate (PubChem CID 143137328) has the molecular formula C26H36N4O2S and a molecular weight of 468.67 g/mol. Its IUPAC name is 2-N-[2-[4-(spiro[4.6]undecan-9-ylideneamino)phenyl]ethyl]-1,3-benzothiazole-2,6-diamine;dihydrate.
| Compound Name | 2-N-[2-[4-(spiro[4.6]undecan-9-ylideneamino)phenyl]ethyl]-1,3-benzothiazole-2,6-diamine;dihydrate |
|---|---|
| PubChem CID | 143137328 |
| Molecular Formula | C26H36N4O2S |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 2-N-[2-[4-(spiro[4.6]undecan-9-ylideneamino)phenyl]ethyl]-1,3-benzothiazole-2,6-diamine;dihydrate |
| SMILES | Nc1ccc2nc(NCCc3ccc(/N=C4\CCCC5(CCCC5)CC4)cc3)sc2c1.O.O |
| InChI | InChI=1S/C26H32N4S.2H2O/c27-20-7-10-23-24(18-20)31-25(30-23)28-17-12-19-5-8-22(9-6-19)29-21-4-3-15-26(16-11-21)13-1-2-14-26;;/h5-10,18H,1-4,11-17,27H2,(H,28,30);2*1H2/b29-21+;; |
| InChIKey | UCDVGLLQOGZEHG-SCXLWNKFSA-N |
| XLogP | 5.48 |
| TPSA | 126.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|