C21H21FN4S2 — CID 76842836
N-[2-[4-(5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylideneamino)phenyl]ethyl]-6-fluoro-1,3-benzothiazol-2-amine (PubChem CID 76842836) has the molecular formula C21H21FN4S2 and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[2-[4-(5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylideneamino)phenyl]ethyl]-6-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | N-[2-[4-(5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylideneamino)phenyl]ethyl]-6-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 76842836 |
| Molecular Formula | C21H21FN4S2 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[2-[4-(5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylideneamino)phenyl]ethyl]-6-fluoro-1,3-benzothiazol-2-amine |
| SMILES | Fc1ccc2nc(NCCc3ccc(/N=C4\SCC5CCCN45)cc3)sc2c1 |
| InChI | InChI=1S/C21H21FN4S2/c22-15-5-8-18-19(12-15)28-20(25-18)23-10-9-14-3-6-16(7-4-14)24-21-26-11-1-2-17(26)13-27-21/h3-8,12,17H,1-2,9-11,13H2,(H,23,25)/b24-21- |
| InChIKey | XRNIHJVRLLQLGN-FLFQWRMESA-N |
| XLogP | 5.29 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|