C20H22N4S2 — CID 58627829
6-methyl-N-[2-[4-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]phenyl]ethyl]-1,3-benzothiazol-2-amine (PubChem CID 58627829) has the molecular formula C20H22N4S2 and a molecular weight of 382.56 g/mol. Its IUPAC name is 6-methyl-N-[2-[4-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]phenyl]ethyl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-methyl-N-[2-[4-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]phenyl]ethyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 58627829 |
| Molecular Formula | C20H22N4S2 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-methyl-N-[2-[4-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]phenyl]ethyl]-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc2nc(NCCc3ccc(/N=C4/SCCN4C)cc3)sc2c1 |
| InChI | InChI=1S/C20H22N4S2/c1-14-3-8-17-18(13-14)26-19(23-17)21-10-9-15-4-6-16(7-5-15)22-20-24(2)11-12-25-20/h3-8,13H,9-12H2,1-2H3,(H,21,23)/b22-20+ |
| InChIKey | JFBOERVKFBBNPO-LSDHQDQOSA-N |
| XLogP | 4.93 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|