C22H23N3S2 — CID 143137333
N-[2-[2-[(E)-[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]methyl]phenyl]ethyl]-1,3-benzothiazol-2-amine (PubChem CID 143137333) has the molecular formula C22H23N3S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is N-[2-[2-[(E)-[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]methyl]phenyl]ethyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[2-[2-[(E)-[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]methyl]phenyl]ethyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 143137333 |
| Molecular Formula | C22H23N3S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[2-[2-[(E)-[(7aS)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]methyl]phenyl]ethyl]-1,3-benzothiazol-2-amine |
| SMILES | C(=C1/SC[C@@H]2CCCN12)\c1ccccc1CCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H23N3S2/c1-2-7-17(14-21-25-13-5-8-18(25)15-26-21)16(6-1)11-12-23-22-24-19-9-3-4-10-20(19)27-22/h1-4,6-7,9-10,14,18H,5,8,11-13,15H2,(H,23,24)/b21-14+/t18-/m0/s1 |
| InChIKey | BSKIXKXFKCKRAQ-SXZORUHJSA-N |
| XLogP | 5.46 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |