C16H13F3N2S — CID 82549328
N-(2-phenylethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-amine (PubChem CID 82549328) has the molecular formula C16H13F3N2S and a molecular weight of 322.36 g/mol. Its IUPAC name is N-(2-phenylethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(2-phenylethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549328 |
| Molecular Formula | C16H13F3N2S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-(2-phenylethyl)-6-(trifluoromethyl)-1,3-benzothiazol-2-amine |
| SMILES | FC(F)(F)c1ccc2nc(NCCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C16H13F3N2S/c17-16(18,19)12-6-7-13-14(10-12)22-15(21-13)20-9-8-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,20,21) |
| InChIKey | KGMLBJAXLCZSBU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |