C24H21N4PS2 — CID 143137295
N-[2-[4-[[4-(2-phosphanylphenyl)-1,3-thiazol-2-yl]amino]phenyl]ethyl]-1,3-benzothiazol-2-amine (PubChem CID 143137295) has the molecular formula C24H21N4PS2 and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[2-[4-[[4-(2-phosphanylphenyl)-1,3-thiazol-2-yl]amino]phenyl]ethyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[2-[4-[[4-(2-phosphanylphenyl)-1,3-thiazol-2-yl]amino]phenyl]ethyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 143137295 |
| Molecular Formula | C24H21N4PS2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | N-[2-[4-[[4-(2-phosphanylphenyl)-1,3-thiazol-2-yl]amino]phenyl]ethyl]-1,3-benzothiazol-2-amine |
| SMILES | Pc1ccccc1-c1csc(Nc2ccc(CCNc3nc4ccccc4s3)cc2)n1 |
| InChI | InChI=1S/C24H21N4PS2/c29-21-7-3-1-5-18(21)20-15-30-24(28-20)26-17-11-9-16(10-12-17)13-14-25-23-27-19-6-2-4-8-22(19)31-23/h1-12,15H,13-14,29H2,(H,25,27)(H,26,28) |
| InChIKey | CDSJHLOPUQGSFX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|