C20H22N4OS — CID 143137308
N-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]phenyl]-N'-(2-oxopropyl)ethanimidamide (PubChem CID 143137308) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]phenyl]-N'-(2-oxopropyl)ethanimidamide.
| Compound Name | N-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]phenyl]-N'-(2-oxopropyl)ethanimidamide |
|---|---|
| PubChem CID | 143137308 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[4-[2-(1,3-benzothiazol-2-ylamino)ethyl]phenyl]-N'-(2-oxopropyl)ethanimidamide |
| SMILES | CC(=O)C/N=C(\C)Nc1ccc(CCNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H22N4OS/c1-14(25)13-22-15(2)23-17-9-7-16(8-10-17)11-12-21-20-24-18-5-3-4-6-19(18)26-20/h3-10H,11-13H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | KLYDIHOEGVTILV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|