C12H16N2S — CID 82549501
5,7-dimethyl-N-propyl-1,3-benzothiazol-2-amine (PubChem CID 82549501) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 5,7-dimethyl-N-propyl-1,3-benzothiazol-2-amine.
| Compound Name | 5,7-dimethyl-N-propyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549501 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5,7-dimethyl-N-propyl-1,3-benzothiazol-2-amine |
| SMILES | CCCNc1nc2cc(C)cc(C)c2s1 |
| InChI | InChI=1S/C12H16N2S/c1-4-5-13-12-14-10-7-8(2)6-9(3)11(10)15-12/h6-7H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | XEGYBYMAHVGGKD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |