C9H10N3O4PS — CID 23933114
[(6-methyl-1,3-benzothiazol-2-yl)carbamoylamino]phosphonic acid (PubChem CID 23933114) has the molecular formula C9H10N3O4PS and a molecular weight of 287.24 g/mol. Its IUPAC name is [(6-methyl-1,3-benzothiazol-2-yl)carbamoylamino]phosphonic acid.
| Compound Name | [(6-methyl-1,3-benzothiazol-2-yl)carbamoylamino]phosphonic acid |
|---|---|
| PubChem CID | 23933114 |
| Molecular Formula | C9H10N3O4PS |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | [(6-methyl-1,3-benzothiazol-2-yl)carbamoylamino]phosphonic acid |
| SMILES | Cc1ccc2nc(NC(=O)NP(=O)(O)O)sc2c1 |
| InChI | InChI=1S/C9H10N3O4PS/c1-5-2-3-6-7(4-5)18-9(10-6)11-8(13)12-17(14,15)16/h2-4H,1H3,(H4,10,11,12,13,14,15,16) |
| InChIKey | ANTKECSJOFNXNW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|