C20H17N3O2 — CID 893610
1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-naphthalen-2-ylurea (PubChem CID 893610) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-naphthalen-2-ylurea.
| Compound Name | 1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-naphthalen-2-ylurea |
|---|---|
| PubChem CID | 893610 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-naphthalen-2-ylurea |
| SMILES | Cc1nc2cc(NC(=O)N(C)c3ccc4ccccc4c3)ccc2o1 |
| InChI | InChI=1S/C20H17N3O2/c1-13-21-18-12-16(8-10-19(18)25-13)22-20(24)23(2)17-9-7-14-5-3-4-6-15(14)11-17/h3-12H,1-2H3,(H,22,24) |
| InChIKey | WVFPLVHYQKUNBE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |