C16H15N3O2 — CID 126146253
1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenylurea (PubChem CID 126146253) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenylurea.
| Compound Name | 1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenylurea |
|---|---|
| PubChem CID | 126146253 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-methyl-3-(2-methyl-1,3-benzoxazol-5-yl)-1-phenylurea |
| SMILES | Cc1nc2cc(NC(=O)N(C)c3ccccc3)ccc2o1 |
| InChI | InChI=1S/C16H15N3O2/c1-11-17-14-10-12(8-9-15(14)21-11)18-16(20)19(2)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,18,20) |
| InChIKey | CEXQOOXNIOLHAU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |